About 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine
5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine (PubChem CID 167496514) has the molecular formula C13H25N3O2
and a molecular weight of 255.36 g/mol. Its IUPAC name is 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine.
Molecular Properties
| Compound Name | 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine |
| PubChem CID | 167496514 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine |
| SMILES | CC(C)(C)CCCC(=O)O.Cn1nccc1CN |
| InChI | InChI=1S/C8H16O2.C5H9N3/c1-8(2,3)6-4-5-7(9)10;1-8-5(4-6)2-3-7-8/h4-6H2,1-3H3,(H,9,10);2-3H,4,6H2,1H3 |
| InChIKey | DXLFHGLUVYGLJH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine?
The IUPAC name of 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine (CID 167496514) is 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine.
What is the SMILES notation for 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine?
The canonical SMILES for 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine is CC(C)(C)CCCC(=O)O.Cn1nccc1CN.
What is the InChIKey of 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine?
The InChIKey is DXLFHGLUVYGLJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C5H9N3/c1-8(2,3)6-4-5-7(9)10;1-8-5(4-6)2-3-7-8/h4-6H2,1-3H3,(H,9,10);2-3H,4,6H2,1H3.
What are the key properties of 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine?
5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine has a molecular weight of 255.36 g/mol, XLogP of 2.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylhexanoic acid;(2-methylpyrazol-3-yl)methanamine is sourced from PubChem (CID 167496514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).