C12H12BrF3N4O — CID 167497418
(2R)-2-[(7S)-11-bromo-7-methyl-4,6,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 167497418) has the molecular formula C12H12BrF3N4O and a molecular weight of 365.15 g/mol. Its IUPAC name is (2R)-2-[(7S)-11-bromo-7-methyl-4,6,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-2-[(7S)-11-bromo-7-methyl-4,6,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 167497418 |
| Molecular Formula | C12H12BrF3N4O |
| Molecular Weight | 365.15 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | (2R)-2-[(7S)-11-bromo-7-methyl-4,6,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-5-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@H]1Cn2nc(Br)cc2-c2cnc([C@@](C)(O)C(F)(F)F)n21 |
| InChI | InChI=1S/C12H12BrF3N4O/c1-6-5-19-7(3-9(13)18-19)8-4-17-10(20(6)8)11(2,21)12(14,15)16/h3-4,6,21H,5H2,1-2H3/t6-,11+/m0/s1 |
| InChIKey | BOMWDNOOKSEHSB-UPONEAKYSA-N |
| XLogP | 2.85 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |