C18H20Cl2FN5O4 — CID 167497710
tert-butyl 4-[(2,7-dichloro-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 167497710) has the molecular formula C18H20Cl2FN5O4 and a molecular weight of 460.29 g/mol. Its IUPAC name is tert-butyl 4-[(2,7-dichloro-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2,7-dichloro-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167497710 |
| Molecular Formula | C18H20Cl2FN5O4 |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | tert-butyl 4-[(2,7-dichloro-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2c([N+](=O)[O-])c(Cl)nc3c(F)c(Cl)ncc23)CC1 |
| InChI | InChI=1S/C18H20Cl2FN5O4/c1-18(2,3)30-17(27)25-6-4-9(5-7-25)23-13-10-8-22-15(19)11(21)12(10)24-16(20)14(13)26(28)29/h8-9H,4-7H2,1-3H3,(H,23,24) |
| InChIKey | NKBLYACRPYFQBZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|