About 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one
4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one (PubChem CID 167498245) has the molecular formula C19H16F3NO2
and a molecular weight of 347.34 g/mol. Its IUPAC name is 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one |
| PubChem CID | 167498245 |
| Molecular Formula | C19H16F3NO2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one |
| SMILES | Cc1ccccc1-c1c[nH]c(=O)c2cc(OC(C)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C19H16F3NO2/c1-11-5-3-4-6-14(11)17-10-23-18(24)16-9-13(7-8-15(16)17)25-12(2)19(20,21)22/h3-10,12H,1-2H3,(H,23,24) |
| InChIKey | VCYKLBLQHLZWAY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one?
The IUPAC name of 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one (CID 167498245) is 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one.
What is the SMILES notation for 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one?
The canonical SMILES for 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one is Cc1ccccc1-c1c[nH]c(=O)c2cc(OC(C)C(F)(F)F)ccc12.
What is the InChIKey of 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one?
The InChIKey is VCYKLBLQHLZWAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F3NO2/c1-11-5-3-4-6-14(11)17-10-23-18(24)16-9-13(7-8-15(16)17)25-12(2)19(20,21)22/h3-10,12H,1-2H3,(H,23,24).
What are the key properties of 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one?
4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one has a molecular weight of 347.34 g/mol, XLogP of 4.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenyl)-7-(1,1,1-trifluoropropan-2-yloxy)-2H-isoquinolin-1-one is sourced from PubChem (CID 167498245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).