About ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol
ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol (PubChem CID 167499413) has the molecular formula C23H25NO5
and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol.
Molecular Properties
| Compound Name | ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol |
| PubChem CID | 167499413 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol |
| SMILES | CCOC(=O)CC.Oc1ccc(Oc2ccc(OCc3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C18H15NO3.C5H10O2/c20-15-6-8-16(9-7-15)22-18-11-10-17(12-19-18)21-13-14-4-2-1-3-5-14;1-3-5(6)7-4-2/h1-12,20H,13H2;3-4H2,1-2H3 |
| InChIKey | JXUAHNIMGLKBGQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol?
The IUPAC name of ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol (CID 167499413) is ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol.
What is the SMILES notation for ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol?
The canonical SMILES for ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol is CCOC(=O)CC.Oc1ccc(Oc2ccc(OCc3ccccc3)cn2)cc1.
What is the InChIKey of ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol?
The InChIKey is JXUAHNIMGLKBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO3.C5H10O2/c20-15-6-8-16(9-7-15)22-18-11-10-17(12-19-18)21-13-14-4-2-1-3-5-14;1-3-5(6)7-4-2/h1-12,20H,13H2;3-4H2,1-2H3.
What are the key properties of ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol?
ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol has a molecular weight of 395.46 g/mol, XLogP of 5.12, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl propanoate;4-[(5-phenylmethoxy-2-pyridinyl)oxy]phenol is sourced from PubChem (CID 167499413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).