About N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine
N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine (PubChem CID 167499583) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine |
| PubChem CID | 167499583 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine |
| SMILES | COCC(C)N(C)CCC(C)C |
| InChI | InChI=1S/C10H23NO/c1-9(2)6-7-11(4)10(3)8-12-5/h9-10H,6-8H2,1-5H3 |
| InChIKey | VAWOCMHYMJTJDO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine?
The IUPAC name of N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine (CID 167499583) is N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine.
What is the SMILES notation for N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine?
The canonical SMILES for N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine is COCC(C)N(C)CCC(C)C.
What is the InChIKey of N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine?
The InChIKey is VAWOCMHYMJTJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO/c1-9(2)6-7-11(4)10(3)8-12-5/h9-10H,6-8H2,1-5H3.
What are the key properties of N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine?
N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine has a molecular weight of 173.30 g/mol, XLogP of 2.00, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methoxypropan-2-yl)-N,3-dimethylbutan-1-amine is sourced from PubChem (CID 167499583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).