About 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride
8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride (PubChem CID 167500561) has the molecular formula C8H10Cl2FN3
and a molecular weight of 238.09 g/mol. Its IUPAC name is 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride.
Molecular Properties
| Compound Name | 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride |
| PubChem CID | 167500561 |
| Molecular Formula | C8H10Cl2FN3 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride |
| SMILES | Cc1cn2cc(N)cc(F)c2n1.Cl.Cl |
| InChI | InChI=1S/C8H8FN3.2ClH/c1-5-3-12-4-6(10)2-7(9)8(12)11-5;;/h2-4H,10H2,1H3;2*1H |
| InChIKey | NOCNSQFXEVWBTH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride?
The IUPAC name of 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride (CID 167500561) is 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride.
What is the SMILES notation for 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride?
The canonical SMILES for 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride is Cc1cn2cc(N)cc(F)c2n1.Cl.Cl.
What is the InChIKey of 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride?
The InChIKey is NOCNSQFXEVWBTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3.2ClH/c1-5-3-12-4-6(10)2-7(9)8(12)11-5;;/h2-4H,10H2,1H3;2*1H.
What are the key properties of 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride?
8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride has a molecular weight of 238.09 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2-methylimidazo[1,2-a]pyridin-6-amine;dihydrochloride is sourced from PubChem (CID 167500561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).