C22H25N7O2 — CID 167501120
N-(4-hydroxy-2,7-dimethylindazol-5-yl)-2-methyl-4-piperazin-1-ylindazole-7-carboxamide (PubChem CID 167501120) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-(4-hydroxy-2,7-dimethylindazol-5-yl)-2-methyl-4-piperazin-1-ylindazole-7-carboxamide.
| Compound Name | N-(4-hydroxy-2,7-dimethylindazol-5-yl)-2-methyl-4-piperazin-1-ylindazole-7-carboxamide |
|---|---|
| PubChem CID | 167501120 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-(4-hydroxy-2,7-dimethylindazol-5-yl)-2-methyl-4-piperazin-1-ylindazole-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(N3CCNCC3)c3cn(C)nc23)c(O)c2cn(C)nc12 |
| InChI | InChI=1S/C22H25N7O2/c1-13-10-17(21(30)16-12-28(3)25-19(13)16)24-22(31)14-4-5-18(29-8-6-23-7-9-29)15-11-27(2)26-20(14)15/h4-5,10-12,23,30H,6-9H2,1-3H3,(H,24,31) |
| InChIKey | BJERKWFCTDOUCY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|