C21H24N8S — CID 167502570
4-(1H-pyrazol-4-yl)-7-[3-(3,3,5,5-tetramethylpiperazin-1-yl)-1,2,4-triazin-6-yl]-1,3-benzothiazole (PubChem CID 167502570) has the molecular formula C21H24N8S and a molecular weight of 420.55 g/mol. Its IUPAC name is 4-(1H-pyrazol-4-yl)-7-[3-(3,3,5,5-tetramethylpiperazin-1-yl)-1,2,4-triazin-6-yl]-1,3-benzothiazole.
| Compound Name | 4-(1H-pyrazol-4-yl)-7-[3-(3,3,5,5-tetramethylpiperazin-1-yl)-1,2,4-triazin-6-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 167502570 |
| Molecular Formula | C21H24N8S |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-(1H-pyrazol-4-yl)-7-[3-(3,3,5,5-tetramethylpiperazin-1-yl)-1,2,4-triazin-6-yl]-1,3-benzothiazole |
| SMILES | CC1(C)CN(c2ncc(-c3ccc(-c4cn[nH]c4)c4ncsc34)nn2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H24N8S/c1-20(2)10-29(11-21(3,4)28-20)19-22-9-16(26-27-19)15-6-5-14(13-7-24-25-8-13)17-18(15)30-12-23-17/h5-9,12,28H,10-11H2,1-4H3,(H,24,25) |
| InChIKey | BWPHPUGXCKFHFY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |