About butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine
butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine (PubChem CID 167502711) has the molecular formula C20H25N7
and a molecular weight of 363.47 g/mol. Its IUPAC name is butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine.
Molecular Properties
| Compound Name | butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine |
| PubChem CID | 167502711 |
| Molecular Formula | C20H25N7 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine |
| SMILES | CCCC.CN(C)c1ccc(-c2ccc(-c3cn[nH]c3)c3[nH]ncc23)nn1 |
| InChI | InChI=1S/C16H15N7.C4H10/c1-23(2)15-6-5-14(20-21-15)12-4-3-11(10-7-17-18-8-10)16-13(12)9-19-22-16;1-3-4-2/h3-9H,1-2H3,(H,17,18)(H,19,22);3-4H2,1-2H3 |
| InChIKey | WHIUBRZQYJQVDJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine?
The IUPAC name of butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine (CID 167502711) is butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine.
What is the SMILES notation for butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine?
The canonical SMILES for butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine is CCCC.CN(C)c1ccc(-c2ccc(-c3cn[nH]c3)c3[nH]ncc23)nn1.
What is the InChIKey of butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine?
The InChIKey is WHIUBRZQYJQVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N7.C4H10/c1-23(2)15-6-5-14(20-21-15)12-4-3-11(10-7-17-18-8-10)16-13(12)9-19-22-16;1-3-4-2/h3-9H,1-2H3,(H,17,18)(H,19,22);3-4H2,1-2H3.
What are the key properties of butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine?
butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine has a molecular weight of 363.47 g/mol, XLogP of 4.28, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butane;N,N-dimethyl-6-[7-(1H-pyrazol-4-yl)-1H-indazol-4-yl]pyridazin-3-amine is sourced from PubChem (CID 167502711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).