C20H19N3O3 — CID 16750272
(9E)-7,12,26-trioxa-19,21,24-triazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2,4,9,14(25),15,17,20,22-nonaene (PubChem CID 16750272) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (9E)-7,12,26-trioxa-19,21,24-triazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2,4,9,14(25),15,17,20,22-nonaene.
| Compound Name | (9E)-7,12,26-trioxa-19,21,24-triazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2,4,9,14(25),15,17,20,22-nonaene |
|---|---|
| PubChem CID | 16750272 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (9E)-7,12,26-trioxa-19,21,24-triazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2,4,9,14(25),15,17,20,22-nonaene |
| SMILES | C1=C/COCc2ccc(o2)-c2ccnc(n2)Nc2cccc(c2)COC/1 |
| InChI | InChI=1S/C20H19N3O3/c1-2-11-25-14-17-6-7-19(26-17)18-8-9-21-20(23-18)22-16-5-3-4-15(12-16)13-24-10-1/h1-9,12H,10-11,13-14H2,(H,21,22,23)/b2-1+ |
| InChIKey | RADMAAOUVWABJD-OWOJBTEDSA-N |
| XLogP | 4.08 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|