C26H30N4O4 — CID 16750327
(9E)-15-(2-pyrrolidin-1-ylethoxy)-3,7,12-trioxa-19,21,24-triazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2(26),4,9,14,16,18(25),20,22-nonaene (PubChem CID 16750327) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is (9E)-15-(2-pyrrolidin-1-ylethoxy)-3,7,12-trioxa-19,21,24-triazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2(26),4,9,14,16,18(25),20,22-nonaene.
| Compound Name | (9E)-15-(2-pyrrolidin-1-ylethoxy)-3,7,12-trioxa-19,21,24-triazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2(26),4,9,14,16,18(25),20,22-nonaene |
|---|---|
| PubChem CID | 16750327 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (9E)-15-(2-pyrrolidin-1-ylethoxy)-3,7,12-trioxa-19,21,24-triazatetracyclo[18.3.1.12,5.114,18]hexacosa-1(24),2(26),4,9,14,16,18(25),20,22-nonaene |
| SMILES | C1=C\COCc2cc(ccc2OCCN2CCCC2)Nc2nccc(n2)-c2cc(co2)COC/1 |
| InChI | InChI=1S/C26H30N4O4/c1-2-10-30(9-1)11-14-33-24-6-5-22-16-21(24)19-32-13-4-3-12-31-17-20-15-25(34-18-20)23-7-8-27-26(28-22)29-23/h3-8,15-16,18H,1-2,9-14,17,19H2,(H,27,28,29)/b4-3- |
| InChIKey | IPKRPPJQWDGNHK-ARJAWSKDSA-N |
| XLogP | 4.56 |
| TPSA | 81.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|