C27H31N5O3 — CID 16750328
(16E)-11-(2-pyrrolidin-1-ylethoxy)-14,19-dioxa-5,7,23,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaene (PubChem CID 16750328) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is (16E)-11-(2-pyrrolidin-1-ylethoxy)-14,19-dioxa-5,7,23,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaene.
| Compound Name | (16E)-11-(2-pyrrolidin-1-ylethoxy)-14,19-dioxa-5,7,23,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaene |
|---|---|
| PubChem CID | 16750328 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (16E)-11-(2-pyrrolidin-1-ylethoxy)-14,19-dioxa-5,7,23,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaene |
| SMILES | C1=C/COCc2cc(ccc2OCCN2CCCC2)Nc2nccc(n2)-c2cncc(c2)COC/1 |
| InChI | InChI=1S/C27H31N5O3/c1-2-10-32(9-1)11-14-35-26-6-5-24-16-23(26)20-34-13-4-3-12-33-19-21-15-22(18-28-17-21)25-7-8-29-27(30-24)31-25/h3-8,15-18H,1-2,9-14,19-20H2,(H,29,30,31)/b4-3+ |
| InChIKey | UDJDOFKOOAFZRH-ONEGZZNKSA-N |
| XLogP | 4.36 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|