About 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane
2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane (PubChem CID 167503432) has the molecular formula C13H16IN3OS
and a molecular weight of 389.26 g/mol. Its IUPAC name is 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane.
Molecular Properties
| Compound Name | 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane |
| PubChem CID | 167503432 |
| Molecular Formula | C13H16IN3OS |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane |
| SMILES | C/C(=N\N)c1ccc(-c2cnc(C)s2)cc1O.CI |
| InChI | InChI=1S/C12H13N3OS.CH3I/c1-7(15-13)10-4-3-9(5-11(10)16)12-6-14-8(2)17-12;1-2/h3-6,16H,13H2,1-2H3;1H3/b15-7+; |
| InChIKey | FXHWOIWEXJDMQS-HAZZGOGXSA-N |
| XLogP | 3.56 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane?
The IUPAC name of 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane (CID 167503432) is 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane.
What is the SMILES notation for 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane?
The canonical SMILES for 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane is C/C(=N\N)c1ccc(-c2cnc(C)s2)cc1O.CI.
What is the InChIKey of 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane?
The InChIKey is FXHWOIWEXJDMQS-HAZZGOGXSA-N. The full InChI is InChI=1S/C12H13N3OS.CH3I/c1-7(15-13)10-4-3-9(5-11(10)16)12-6-14-8(2)17-12;1-2/h3-6,16H,13H2,1-2H3;1H3/b15-7+;.
What are the key properties of 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane?
2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane has a molecular weight of 389.26 g/mol, XLogP of 3.56, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethanehydrazonoyl-5-(2-methyl-1,3-thiazol-5-yl)phenol;iodomethane is sourced from PubChem (CID 167503432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).