C24H26FN5O2S — CID 167503617
2-[6-[(3R)-3-(cyclobutylamino)sulfanylpyrrolidin-1-yl]pyridazin-3-yl]-4-fluoro-5-(5-methoxy-3-pyridinyl)phenol (PubChem CID 167503617) has the molecular formula C24H26FN5O2S and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[6-[(3R)-3-(cyclobutylamino)sulfanylpyrrolidin-1-yl]pyridazin-3-yl]-4-fluoro-5-(5-methoxy-3-pyridinyl)phenol.
| Compound Name | 2-[6-[(3R)-3-(cyclobutylamino)sulfanylpyrrolidin-1-yl]pyridazin-3-yl]-4-fluoro-5-(5-methoxy-3-pyridinyl)phenol |
|---|---|
| PubChem CID | 167503617 |
| Molecular Formula | C24H26FN5O2S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 2-[6-[(3R)-3-(cyclobutylamino)sulfanylpyrrolidin-1-yl]pyridazin-3-yl]-4-fluoro-5-(5-methoxy-3-pyridinyl)phenol |
| SMILES | COc1cncc(-c2cc(O)c(-c3ccc(N4CC[C@@H](SNC5CCC5)C4)nn3)cc2F)c1 |
| InChI | InChI=1S/C24H26FN5O2S/c1-32-17-9-15(12-26-13-17)19-11-23(31)20(10-21(19)25)22-5-6-24(28-27-22)30-8-7-18(14-30)33-29-16-3-2-4-16/h5-6,9-13,16,18,29,31H,2-4,7-8,14H2,1H3/t18-/m1/s1 |
| InChIKey | FMZJPBAIJWTMRY-GOSISDBHSA-N |
| XLogP | 4.43 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|