C36H58O5 — CID 16750436
4-[[(3S,6aR,6bR,8aR,12S,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 16750436) has the molecular formula C36H58O5 and a molecular weight of 570.86 g/mol. Its IUPAC name is 4-[[(3S,6aR,6bR,8aR,12S,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[[(3S,6aR,6bR,8aR,12S,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 16750436 |
| Molecular Formula | C36H58O5 |
| Molecular Weight | 570.86 g/mol |
| Exact Mass | 570.43 |
| IUPAC Name | 4-[[(3S,6aR,6bR,8aR,12S,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC1=CC[C@]2(CO)CC[C@]3(C)C(CCC4[C@@]5(C)CC[C@H](OC(=O)CC(C)(C)C(=O)O)C(C)(C)C5CC[C@]43C)C2C1C |
| InChI | InChI=1S/C36H58O5/c1-22-12-17-36(21-37)19-18-34(8)24(29(36)23(22)2)10-11-26-33(7)15-14-27(41-28(38)20-31(3,4)30(39)40)32(5,6)25(33)13-16-35(26,34)9/h12,23-27,29,37H,10-11,13-21H2,1-9H3,(H,39,40)/t23?,24?,25?,26?,27-,29?,33-,34+,35+,36+/m0/s1 |
| InChIKey | JHOOOCKQYKPYAL-GCQIPHGWSA-N |
| XLogP | 8.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.86 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|