C24H22N4O5S — CID 167504646
methyl 5-[3-[(Z)-C-aminocarbonohydrazonoyl]phenoxy]-1-(4-methylphenyl)sulfonylindole-4-carboxylate (PubChem CID 167504646) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is methyl 5-[3-[(Z)-C-aminocarbonohydrazonoyl]phenoxy]-1-(4-methylphenyl)sulfonylindole-4-carboxylate.
| Compound Name | methyl 5-[3-[(Z)-C-aminocarbonohydrazonoyl]phenoxy]-1-(4-methylphenyl)sulfonylindole-4-carboxylate |
|---|---|
| PubChem CID | 167504646 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | methyl 5-[3-[(Z)-C-aminocarbonohydrazonoyl]phenoxy]-1-(4-methylphenyl)sulfonylindole-4-carboxylate |
| SMILES | COC(=O)c1c(Oc2cccc(/C(N)=N/N)c2)ccc2c1ccn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-15-6-8-18(9-7-15)34(30,31)28-13-12-19-20(28)10-11-21(22(19)24(29)32-2)33-17-5-3-4-16(14-17)23(25)27-26/h3-14H,26H2,1-2H3,(H2,25,27) |
| InChIKey | NRVKIUROCNWJDA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|