About 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine
2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine (PubChem CID 16750521) has the molecular formula C18H12N2S2
and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine.
Molecular Properties
| Compound Name | 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine |
| PubChem CID | 16750521 |
| Molecular Formula | C18H12N2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine |
| SMILES | c1csc(-c2cc(-c3ccncc3)nc(-c3cccs3)c2)c1 |
| InChI | InChI=1S/C18H12N2S2/c1-3-17(21-9-1)14-11-15(13-5-7-19-8-6-13)20-16(12-14)18-4-2-10-22-18/h1-12H |
| InChIKey | KTCKQMOKXAGSLU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine?
The IUPAC name of 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine (CID 16750521) is 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine.
What is the SMILES notation for 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine?
The canonical SMILES for 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine is c1csc(-c2cc(-c3ccncc3)nc(-c3cccs3)c2)c1.
What is the InChIKey of 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine?
The InChIKey is KTCKQMOKXAGSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2S2/c1-3-17(21-9-1)14-11-15(13-5-7-19-8-6-13)20-16(12-14)18-4-2-10-22-18/h1-12H.
What are the key properties of 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine?
2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine has a molecular weight of 320.44 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-yl-4,6-dithiophen-2-ylpyridine is sourced from PubChem (CID 16750521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).