C30H30N4O3 — CID 167505454
7-[3-[[3-[3-(1H-indol-5-yloxy)phenyl]-1H-1,2,4-triazol-5-yl]methyl]phenyl]heptanoic acid (PubChem CID 167505454) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is 7-[3-[[3-[3-(1H-indol-5-yloxy)phenyl]-1H-1,2,4-triazol-5-yl]methyl]phenyl]heptanoic acid.
| Compound Name | 7-[3-[[3-[3-(1H-indol-5-yloxy)phenyl]-1H-1,2,4-triazol-5-yl]methyl]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 167505454 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 7-[3-[[3-[3-(1H-indol-5-yloxy)phenyl]-1H-1,2,4-triazol-5-yl]methyl]phenyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCc1cccc(Cc2nc(-c3cccc(Oc4ccc5[nH]ccc5c4)c3)n[nH]2)c1 |
| InChI | InChI=1S/C30H30N4O3/c35-29(36)12-4-2-1-3-7-21-8-5-9-22(17-21)18-28-32-30(34-33-28)24-10-6-11-25(20-24)37-26-13-14-27-23(19-26)15-16-31-27/h5-6,8-11,13-17,19-20,31H,1-4,7,12,18H2,(H,35,36)(H,32,33,34) |
| InChIKey | UFYNBUAEGLPUGZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|