About 4-tert-butyl-1,1-dihydroperoxycyclohexane
4-tert-butyl-1,1-dihydroperoxycyclohexane (PubChem CID 16750617) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-tert-butyl-1,1-dihydroperoxycyclohexane.
Molecular Properties
| Compound Name | 4-tert-butyl-1,1-dihydroperoxycyclohexane |
| PubChem CID | 16750617 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-tert-butyl-1,1-dihydroperoxycyclohexane |
| SMILES | CC(C)(C)C1CCC(OO)(OO)CC1 |
| InChI | InChI=1S/C10H20O4/c1-9(2,3)8-4-6-10(13-11,14-12)7-5-8/h8,11-12H,4-7H2,1-3H3 |
| InChIKey | LWGYYSIEPWXJMS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-1,1-dihydroperoxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,1-dihydroperoxycyclohexane?
The IUPAC name of 4-tert-butyl-1,1-dihydroperoxycyclohexane (CID 16750617) is 4-tert-butyl-1,1-dihydroperoxycyclohexane.
What is the SMILES notation for 4-tert-butyl-1,1-dihydroperoxycyclohexane?
The canonical SMILES for 4-tert-butyl-1,1-dihydroperoxycyclohexane is CC(C)(C)C1CCC(OO)(OO)CC1.
What is the InChIKey of 4-tert-butyl-1,1-dihydroperoxycyclohexane?
The InChIKey is LWGYYSIEPWXJMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-9(2,3)8-4-6-10(13-11,14-12)7-5-8/h8,11-12H,4-7H2,1-3H3.
What are the key properties of 4-tert-butyl-1,1-dihydroperoxycyclohexane?
4-tert-butyl-1,1-dihydroperoxycyclohexane has a molecular weight of 204.27 g/mol, XLogP of 2.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,1-dihydroperoxycyclohexane is sourced from PubChem (CID 16750617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).