C26H50O6Si2 — CID 16750623
(2R,3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2,4-dimethylhexanal (PubChem CID 16750623) has the molecular formula C26H50O6Si2 and a molecular weight of 514.85 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2,4-dimethylhexanal.
| Compound Name | (2R,3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2,4-dimethylhexanal |
|---|---|
| PubChem CID | 16750623 |
| Molecular Formula | C26H50O6Si2 |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | (2R,3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2,4-dimethylhexanal |
| SMILES | C[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)[C@@H](CC1=CC(=O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O6Si2/c1-18(17-27)23(32-34(13,14)25(6,7)8)19(2)21(31-33(11,12)24(3,4)5)15-20-16-22(28)30-26(9,10)29-20/h16-19,21,23H,15H2,1-14H3/t18-,19-,21+,23+/m0/s1 |
| InChIKey | TYGIJXDSXQETLK-SQXWHWBNSA-N |
| XLogP | 6.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|