C37H74O7Si3 — CID 16750626
2,2-dimethyl-6-[(E,2R,3S,4R,5S,6R)-2,4,10-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-3,5,8-trimethyldec-7-enyl]-1,3-dioxin-4-one (PubChem CID 16750626) has the molecular formula C37H74O7Si3 and a molecular weight of 715.25 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(E,2R,3S,4R,5S,6R)-2,4,10-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-3,5,8-trimethyldec-7-enyl]-1,3-dioxin-4-one.
| Compound Name | 2,2-dimethyl-6-[(E,2R,3S,4R,5S,6R)-2,4,10-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-3,5,8-trimethyldec-7-enyl]-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 16750626 |
| Molecular Formula | C37H74O7Si3 |
| Molecular Weight | 715.25 g/mol |
| Exact Mass | 714.47 |
| IUPAC Name | 2,2-dimethyl-6-[(E,2R,3S,4R,5S,6R)-2,4,10-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-3,5,8-trimethyldec-7-enyl]-1,3-dioxin-4-one |
| SMILES | C/C(=C\[C@@H](O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CC1=CC(=O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H74O7Si3/c1-26(21-22-40-45(15,16)34(4,5)6)23-30(38)27(2)33(44-47(19,20)36(10,11)12)28(3)31(43-46(17,18)35(7,8)9)24-29-25-32(39)42-37(13,14)41-29/h23,25,27-28,30-31,33,38H,21-22,24H2,1-20H3/b26-23+/t27-,28-,30+,31+,33+/m0/s1 |
| InChIKey | JKTBXJWAIXSUNR-KGLHXLDXSA-N |
| XLogP | 10.34 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.25 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|