C21H26BrNSe — CID 16750635
4,4-dimethyl-1-[(1R)-1-phenylethyl]-2-(phenylselanylmethyl)-2,3-dihydropyrrol-1-ium bromide (PubChem CID 16750635) has the molecular formula C21H26BrNSe and a molecular weight of 451.31 g/mol. Its IUPAC name is 4,4-dimethyl-1-[(1R)-1-phenylethyl]-2-(phenylselanylmethyl)-2,3-dihydropyrrol-1-ium bromide.
| Compound Name | 4,4-dimethyl-1-[(1R)-1-phenylethyl]-2-(phenylselanylmethyl)-2,3-dihydropyrrol-1-ium bromide |
|---|---|
| PubChem CID | 16750635 |
| Molecular Formula | C21H26BrNSe |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 4,4-dimethyl-1-[(1R)-1-phenylethyl]-2-(phenylselanylmethyl)-2,3-dihydropyrrol-1-ium bromide |
| SMILES | C[C@H](c1ccccc1)[N+]1=CC(C)(C)CC1C[Se]c1ccccc1.[Br-] |
| InChI | InChI=1S/C21H26NSe.BrH/c1-17(18-10-6-4-7-11-18)22-16-21(2,3)14-19(22)15-23-20-12-8-5-9-13-20;/h4-13,16-17,19H,14-15H2,1-3H3;1H/q+1;/p-1/t17-,19?;/m1./s1 |
| InChIKey | UXJIREXOESNGNM-OWXCZVATSA-M |
| XLogP | 1.08 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|