C22H20F5N7OS — CID 167506775
5-(3-cyclopropyl-1,2,4-triazin-6-yl)-3-ethylsulfanyl-N-[2-(methylamino)-5-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]pyridine-2-carboxamide (PubChem CID 167506775) has the molecular formula C22H20F5N7OS and a molecular weight of 525.51 g/mol. Its IUPAC name is 5-(3-cyclopropyl-1,2,4-triazin-6-yl)-3-ethylsulfanyl-N-[2-(methylamino)-5-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 5-(3-cyclopropyl-1,2,4-triazin-6-yl)-3-ethylsulfanyl-N-[2-(methylamino)-5-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167506775 |
| Molecular Formula | C22H20F5N7OS |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 5-(3-cyclopropyl-1,2,4-triazin-6-yl)-3-ethylsulfanyl-N-[2-(methylamino)-5-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]pyridine-2-carboxamide |
| SMILES | CCSc1cc(-c2cnc(C3CC3)nn2)cnc1C(=O)Nc1cc(C(F)(F)C(F)(F)F)cnc1NC |
| InChI | InChI=1S/C22H20F5N7OS/c1-3-36-16-6-12(15-10-31-18(34-33-15)11-4-5-11)8-29-17(16)20(35)32-14-7-13(9-30-19(14)28-2)21(23,24)22(25,26)27/h6-11H,3-5H2,1-2H3,(H,28,30)(H,32,35) |
| InChIKey | INPUCQQCDAVFNW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|