C46H56O4S12 — CID 167507351
4-[bis(8-acetyl-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiole-8-carboxylic acid;ethane (PubChem CID 167507351) has the molecular formula C46H56O4S12 and a molecular weight of 1057.75 g/mol. Its IUPAC name is 4-[bis(8-acetyl-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiole-8-carboxylic acid;ethane.
| Compound Name | 4-[bis(8-acetyl-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiole-8-carboxylic acid;ethane |
|---|---|
| PubChem CID | 167507351 |
| Molecular Formula | C46H56O4S12 |
| Molecular Weight | 1057.75 g/mol |
| Exact Mass | 1056.08 |
| IUPAC Name | 4-[bis(8-acetyl-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiole-8-carboxylic acid;ethane |
| SMILES | CC.CC.CC(=O)c1c2c(c(C(c3c4c(c(C(C)=O)c5c3SC(C)(C)S5)SC(C)(C)S4)c3c4c(c(C(=O)O)c5c3SC(C)(C)S5)SC(C)(C)S4)c3c1SC(C)(C)S3)SC(C)(C)S2 |
| InChI | InChI=1S/C42H44O4S12.2C2H6/c1-15(43)17-24-28(51-37(3,4)47-24)20(29-25(17)48-38(5,6)52-29)19(21-30-26(49-39(7,8)53-30)18(16(2)44)27-31(21)54-40(9,10)50-27)22-32-34(57-41(11,12)55-32)23(36(45)46)35-33(22)56-42(13,14)58-35;2*1-2/h19H,1-14H3,(H,45,46);2*1-2H3 |
| InChIKey | BKWYHYVUNYYHQU-UHFFFAOYSA-N |
| XLogP | 18.63 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.75 |
| LogP ≤ 5 | 18.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|