C16H15NO2 — CID 16750773
(2S,6S)-2,6-diphenyl-1,3-oxazinan-4-one (PubChem CID 16750773) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2S,6S)-2,6-diphenyl-1,3-oxazinan-4-one.
| Compound Name | (2S,6S)-2,6-diphenyl-1,3-oxazinan-4-one |
|---|---|
| PubChem CID | 16750773 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2S,6S)-2,6-diphenyl-1,3-oxazinan-4-one |
| SMILES | O=C1C[C@@H](c2ccccc2)O[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C16H15NO2/c18-15-11-14(12-7-3-1-4-8-12)19-16(17-15)13-9-5-2-6-10-13/h1-10,14,16H,11H2,(H,17,18)/t14-,16-/m0/s1 |
| InChIKey | GYFMHRXQPIPBMT-HOCLYGCPSA-N |
| XLogP | 2.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |