C19H13Cl2F6N3OS2 — CID 167507885
5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2-difluoroethyl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carbothioamide (PubChem CID 167507885) has the molecular formula C19H13Cl2F6N3OS2 and a molecular weight of 548.36 g/mol. Its IUPAC name is 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2-difluoroethyl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carbothioamide.
| Compound Name | 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2-difluoroethyl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carbothioamide |
|---|---|
| PubChem CID | 167507885 |
| Molecular Formula | C19H13Cl2F6N3OS2 |
| Molecular Weight | 548.36 g/mol |
| Exact Mass | 546.98 |
| IUPAC Name | 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2-difluoroethyl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carbothioamide |
| SMILES | Fc1c(Cl)cc(C2(C(F)(F)F)CC(N3Cc4cc(C(=S)NCC(F)F)sc4C3)=NO2)cc1Cl |
| InChI | InChI=1S/C19H13Cl2F6N3OS2/c20-10-2-9(3-11(21)16(10)24)18(19(25,26)27)4-15(29-31-18)30-6-8-1-12(33-13(8)7-30)17(32)28-5-14(22)23/h1-3,14H,4-7H2,(H,28,32) |
| InChIKey | XTFVAWKMHGPEFV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|