About ethane;pyrimidine-4-carboxamide
ethane;pyrimidine-4-carboxamide (PubChem CID 167507901) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is ethane;pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | ethane;pyrimidine-4-carboxamide |
| PubChem CID | 167507901 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | ethane;pyrimidine-4-carboxamide |
| SMILES | CC.NC(=O)c1ccncn1 |
| InChI | InChI=1S/C5H5N3O.C2H6/c6-5(9)4-1-2-7-3-8-4;1-2/h1-3H,(H2,6,9);1-2H3 |
| InChIKey | DWUVVQFBFNCXOS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pyrimidine-4-carboxamide?
The IUPAC name of ethane;pyrimidine-4-carboxamide (CID 167507901) is ethane;pyrimidine-4-carboxamide.
What is the SMILES notation for ethane;pyrimidine-4-carboxamide?
The canonical SMILES for ethane;pyrimidine-4-carboxamide is CC.NC(=O)c1ccncn1.
What is the InChIKey of ethane;pyrimidine-4-carboxamide?
The InChIKey is DWUVVQFBFNCXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O.C2H6/c6-5(9)4-1-2-7-3-8-4;1-2/h1-3H,(H2,6,9);1-2H3.
What are the key properties of ethane;pyrimidine-4-carboxamide?
ethane;pyrimidine-4-carboxamide has a molecular weight of 153.18 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pyrimidine-4-carboxamide is sourced from PubChem (CID 167507901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).