About ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one
ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one (PubChem CID 167507972) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one |
| PubChem CID | 167507972 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one |
| SMILES | C=C/C(OC)=C1/C(=O)N(C)C/C1=C/C.CC.CC |
| InChI | InChI=1S/C11H15NO2.2C2H6/c1-5-8-7-12(3)11(13)10(8)9(6-2)14-4;2*1-2/h5-6H,2,7H2,1,3-4H3;2*1-2H3/b8-5-,10-9-;; |
| InChIKey | XTYKUVOPSYGXOL-AJXXXUAMSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one?
The IUPAC name of ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one (CID 167507972) is ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one.
What is the SMILES notation for ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one?
The canonical SMILES for ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one is C=C/C(OC)=C1/C(=O)N(C)C/C1=C/C.CC.CC.
What is the InChIKey of ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one?
The InChIKey is XTYKUVOPSYGXOL-AJXXXUAMSA-N. The full InChI is InChI=1S/C11H15NO2.2C2H6/c1-5-8-7-12(3)11(13)10(8)9(6-2)14-4;2*1-2/h5-6H,2,7H2,1,3-4H3;2*1-2H3/b8-5-,10-9-;;.
What are the key properties of ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one?
ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one has a molecular weight of 253.39 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z,4E)-4-ethylidene-3-(1-methoxyprop-2-enylidene)-1-methylpyrrolidin-2-one is sourced from PubChem (CID 167507972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).