About 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile
4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile (PubChem CID 16750897) has the molecular formula C18H23N5O2S3
and a molecular weight of 437.62 g/mol. Its IUPAC name is 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile |
| PubChem CID | 16750897 |
| Molecular Formula | C18H23N5O2S3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(SCC(=O)N2CCCC2)nc(SCC(=O)N2CCCC2)c1C#N |
| InChI | InChI=1S/C18H23N5O2S3/c1-26-16-13(10-19)17(27-11-14(24)22-6-2-3-7-22)21-18(20-16)28-12-15(25)23-8-4-5-9-23/h2-9,11-12H2,1H3 |
| InChIKey | JLUSHBRYOPUUOE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile?
The IUPAC name of 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile (CID 16750897) is 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile?
The canonical SMILES for 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile is CSc1nc(SCC(=O)N2CCCC2)nc(SCC(=O)N2CCCC2)c1C#N.
What is the InChIKey of 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile?
The InChIKey is JLUSHBRYOPUUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5O2S3/c1-26-16-13(10-19)17(27-11-14(24)22-6-2-3-7-22)21-18(20-16)28-12-15(25)23-8-4-5-9-23/h2-9,11-12H2,1H3.
What are the key properties of 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile?
4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile has a molecular weight of 437.62 g/mol, XLogP of 2.50, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-2,6-bis[(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl]pyrimidine-5-carbonitrile is sourced from PubChem (CID 16750897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).