C31H42FNO2 — CID 167509815
1-(5-fluoroindol-1-yl)-4-[(3R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-one (PubChem CID 167509815) has the molecular formula C31H42FNO2 and a molecular weight of 479.68 g/mol. Its IUPAC name is 1-(5-fluoroindol-1-yl)-4-[(3R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-one.
| Compound Name | 1-(5-fluoroindol-1-yl)-4-[(3R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-one |
|---|---|
| PubChem CID | 167509815 |
| Molecular Formula | C31H42FNO2 |
| Molecular Weight | 479.68 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | 1-(5-fluoroindol-1-yl)-4-[(3R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-one |
| SMILES | CC12CCC3C(CCC4C[C@H](O)CCC43C)C1CCC2CCCC(=O)n1ccc2cc(F)ccc21 |
| InChI | InChI=1S/C31H42FNO2/c1-30-16-13-27-25(9-6-22-19-24(34)12-15-31(22,27)2)26(30)10-7-21(30)4-3-5-29(35)33-17-14-20-18-23(32)8-11-28(20)33/h8,11,14,17-18,21-22,24-27,34H,3-7,9-10,12-13,15-16,19H2,1-2H3/t21?,22?,24-,25?,26?,27?,30?,31?/m1/s1 |
| InChIKey | VYXGOVUYDIQIRM-KMCQDKBGSA-N |
| XLogP | 7.61 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.68 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |