C31H42ClNO3S — CID 167510075
(1R,2S,5R,9R,10S,12S,13S,16R,18S,20R)-6-[2-(6-chloro-1,3-benzothiazol-2-yl)ethyl]-10-methoxy-13-methylpentacyclo[10.8.0.02,9.05,9.013,18]icosane-16,20-diol (PubChem CID 167510075) has the molecular formula C31H42ClNO3S and a molecular weight of 544.20 g/mol. Its IUPAC name is (1R,2S,5R,9R,10S,12S,13S,16R,18S,20R)-6-[2-(6-chloro-1,3-benzothiazol-2-yl)ethyl]-10-methoxy-13-methylpentacyclo[10.8.0.02,9.05,9.013,18]icosane-16,20-diol.
| Compound Name | (1R,2S,5R,9R,10S,12S,13S,16R,18S,20R)-6-[2-(6-chloro-1,3-benzothiazol-2-yl)ethyl]-10-methoxy-13-methylpentacyclo[10.8.0.02,9.05,9.013,18]icosane-16,20-diol |
|---|---|
| PubChem CID | 167510075 |
| Molecular Formula | C31H42ClNO3S |
| Molecular Weight | 544.20 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (1R,2S,5R,9R,10S,12S,13S,16R,18S,20R)-6-[2-(6-chloro-1,3-benzothiazol-2-yl)ethyl]-10-methoxy-13-methylpentacyclo[10.8.0.02,9.05,9.013,18]icosane-16,20-diol |
| SMILES | CO[C@H]1C[C@H]2[C@@H]([C@H](O)C[C@@H]3C[C@H](O)CC[C@@]32C)[C@@H]2CC[C@@H]3C(CCc4nc5ccc(Cl)cc5s4)CC[C@@]132 |
| InChI | InChI=1S/C31H42ClNO3S/c1-30-11-10-20(34)13-18(30)14-25(35)29-22-6-5-21-17(9-12-31(21,22)27(36-2)16-23(29)30)3-8-28-33-24-7-4-19(32)15-26(24)37-28/h4,7,15,17-18,20-23,25,27,29,34-35H,3,5-6,8-14,16H2,1-2H3/t17?,18-,20+,21+,22-,23-,25+,27-,29-,30-,31+/m0/s1 |
| InChIKey | VTMBNQYWGNYDNK-QMLRLGJYSA-N |
| XLogP | 6.89 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.20 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |