C21H26O3 — CID 16751051
[(3S,5S)-5-hydroxy-1-phenylhexan-3-yl] 3-phenylpropanoate (PubChem CID 16751051) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is [(3S,5S)-5-hydroxy-1-phenylhexan-3-yl] 3-phenylpropanoate.
| Compound Name | [(3S,5S)-5-hydroxy-1-phenylhexan-3-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 16751051 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [(3S,5S)-5-hydroxy-1-phenylhexan-3-yl] 3-phenylpropanoate |
| SMILES | C[C@H](O)C[C@H](CCc1ccccc1)OC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C21H26O3/c1-17(22)16-20(14-12-18-8-4-2-5-9-18)24-21(23)15-13-19-10-6-3-7-11-19/h2-11,17,20,22H,12-16H2,1H3/t17-,20-/m0/s1 |
| InChIKey | NSYYAEODNFHELY-PXNSSMCTSA-N |
| XLogP | 3.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |