C10H17FO6 — CID 167510830
(1R,2S,3R,4R,5R)-2-fluoro-3,4-bis(methoxymethoxy)-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 167510830) has the molecular formula C10H17FO6 and a molecular weight of 252.24 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-2-fluoro-3,4-bis(methoxymethoxy)-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,2S,3R,4R,5R)-2-fluoro-3,4-bis(methoxymethoxy)-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 167510830 |
| Molecular Formula | C10H17FO6 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (1R,2S,3R,4R,5R)-2-fluoro-3,4-bis(methoxymethoxy)-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | COCO[C@H]1[C@@H]2OC[C@@H](O2)[C@H](F)[C@@H]1OCOC |
| InChI | InChI=1S/C10H17FO6/c1-12-4-15-8-7(11)6-3-14-10(17-6)9(8)16-5-13-2/h6-10H,3-5H2,1-2H3/t6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | SKCGZQPKWOYZSM-SOYHJAILSA-N |
| XLogP | 0.06 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|