C23H25FO9 — CID 167510924
[(2R,3S,5R,6S)-3,4-diacetyloxy-5-fluoro-6-[(5-methyl-7-oxo-8H-naphthalen-2-yl)oxy]oxan-2-yl]methyl acetate (PubChem CID 167510924) has the molecular formula C23H25FO9 and a molecular weight of 464.44 g/mol. Its IUPAC name is [(2R,3S,5R,6S)-3,4-diacetyloxy-5-fluoro-6-[(5-methyl-7-oxo-8H-naphthalen-2-yl)oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R,6S)-3,4-diacetyloxy-5-fluoro-6-[(5-methyl-7-oxo-8H-naphthalen-2-yl)oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167510924 |
| Molecular Formula | C23H25FO9 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [(2R,3S,5R,6S)-3,4-diacetyloxy-5-fluoro-6-[(5-methyl-7-oxo-8H-naphthalen-2-yl)oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc3c(c2)CC(=O)C=C3C)[C@H](F)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H25FO9/c1-11-7-16(28)8-15-9-17(5-6-18(11)15)32-23-20(24)22(31-14(4)27)21(30-13(3)26)19(33-23)10-29-12(2)25/h5-7,9,19-23H,8,10H2,1-4H3/t19-,20-,21+,22?,23-/m1/s1 |
| InChIKey | ZHSPYTZYRIKQTL-QXOQWBMLSA-N |
| XLogP | 2.08 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|