C25H26N6O — CID 167511772
5-methyl-N-[4-methyl-3-[7-(methylamino)-1,6-naphthyridin-3-yl]phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 167511772) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 5-methyl-N-[4-methyl-3-[7-(methylamino)-1,6-naphthyridin-3-yl]phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 5-methyl-N-[4-methyl-3-[7-(methylamino)-1,6-naphthyridin-3-yl]phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167511772 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5-methyl-N-[4-methyl-3-[7-(methylamino)-1,6-naphthyridin-3-yl]phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CNc1cc2ncc(-c3cc(NC(=O)c4cnn5c4CC(C)CC5)ccc3C)cc2cn1 |
| InChI | InChI=1S/C25H26N6O/c1-15-6-7-31-23(8-15)21(14-29-31)25(32)30-19-5-4-16(2)20(10-19)17-9-18-13-28-24(26-3)11-22(18)27-12-17/h4-5,9-15H,6-8H2,1-3H3,(H,26,28)(H,30,32) |
| InChIKey | LOOYLNPKRGKHKB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |