C28H28N4O3S — CID 167512078
5-(1-benzothiophene-3-carbonylamino)-6-(2-methylanilino)-N-(oxan-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 167512078) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is 5-(1-benzothiophene-3-carbonylamino)-6-(2-methylanilino)-N-(oxan-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-(1-benzothiophene-3-carbonylamino)-6-(2-methylanilino)-N-(oxan-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167512078 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 5-(1-benzothiophene-3-carbonylamino)-6-(2-methylanilino)-N-(oxan-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccccc1Nc1ncc(C(=O)NCC2CCCOC2)cc1NC(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C28H28N4O3S/c1-18-7-2-4-10-23(18)31-26-24(32-28(34)22-17-36-25-11-5-3-9-21(22)25)13-20(15-29-26)27(33)30-14-19-8-6-12-35-16-19/h2-5,7,9-11,13,15,17,19H,6,8,12,14,16H2,1H3,(H,29,31)(H,30,33)(H,32,34) |
| InChIKey | BPYUOCWAVQLHMB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |