C20H16N4OS — CID 16751237
(E)-2-cyano-N-[(E)-(4-methyl-3-phenyl-1,3-thiazol-2-ylidene)amino]-3-phenylprop-2-enamide (PubChem CID 16751237) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is (E)-2-cyano-N-[(E)-(4-methyl-3-phenyl-1,3-thiazol-2-ylidene)amino]-3-phenylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(E)-(4-methyl-3-phenyl-1,3-thiazol-2-ylidene)amino]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16751237 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (E)-2-cyano-N-[(E)-(4-methyl-3-phenyl-1,3-thiazol-2-ylidene)amino]-3-phenylprop-2-enamide |
| SMILES | Cc1cs/c(=N/NC(=O)/C(C#N)=C/c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H16N4OS/c1-15-14-26-20(24(15)18-10-6-3-7-11-18)23-22-19(25)17(13-21)12-16-8-4-2-5-9-16/h2-12,14H,1H3,(H,22,25)/b17-12+,23-20+ |
| InChIKey | WCZRIBLZZGIWNH-RZPAUPBHSA-N |
| XLogP | 3.39 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|