About 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine
1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 167512635) has the molecular formula C12H17N5O
and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 167512635 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1nn(C2(C)COCC2C)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H17N5O/c1-7-4-18-5-12(7,3)17-11-9(8(2)16-17)10(13)14-6-15-11/h6-7H,4-5H2,1-3H3,(H2,13,14,15) |
| InChIKey | JUDVLDIWXODGJD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine (CID 167512635) is 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine is Cc1nn(C2(C)COCC2C)c2ncnc(N)c12.
What is the InChIKey of 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is JUDVLDIWXODGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O/c1-7-4-18-5-12(7,3)17-11-9(8(2)16-17)10(13)14-6-15-11/h6-7H,4-5H2,1-3H3,(H2,13,14,15).
What are the key properties of 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine?
1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 247.30 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethyloxolan-3-yl)-3-methylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 167512635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).