C21H20N2O6 — CID 167513744
2-[2-(2,2-dimethyl-1,3-benzodioxol-5-yl)-6-methyl-3-oxopyridazine-4-carbonyl]cyclohexane-1,3-dione (PubChem CID 167513744) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[2-(2,2-dimethyl-1,3-benzodioxol-5-yl)-6-methyl-3-oxopyridazine-4-carbonyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-(2,2-dimethyl-1,3-benzodioxol-5-yl)-6-methyl-3-oxopyridazine-4-carbonyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 167513744 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[2-(2,2-dimethyl-1,3-benzodioxol-5-yl)-6-methyl-3-oxopyridazine-4-carbonyl]cyclohexane-1,3-dione |
| SMILES | Cc1cc(C(=O)C2C(=O)CCCC2=O)c(=O)n(-c2ccc3c(c2)OC(C)(C)O3)n1 |
| InChI | InChI=1S/C21H20N2O6/c1-11-9-13(19(26)18-14(24)5-4-6-15(18)25)20(27)23(22-11)12-7-8-16-17(10-12)29-21(2,3)28-16/h7-10,18H,4-6H2,1-3H3 |
| InChIKey | PEEAWGMIZXNQCX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|