C15H22F2N4O3S — CID 167513990
O-ethyl 4-[2-(2,2-difluoroethyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-2-methylpyrimidine-5-carbothioate (PubChem CID 167513990) has the molecular formula C15H22F2N4O3S and a molecular weight of 376.43 g/mol. Its IUPAC name is O-ethyl 4-[2-(2,2-difluoroethyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-2-methylpyrimidine-5-carbothioate.
| Compound Name | O-ethyl 4-[2-(2,2-difluoroethyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-2-methylpyrimidine-5-carbothioate |
|---|---|
| PubChem CID | 167513990 |
| Molecular Formula | C15H22F2N4O3S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | O-ethyl 4-[2-(2,2-difluoroethyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-2-methylpyrimidine-5-carbothioate |
| SMILES | CCOC(=S)c1cnc(C)nc1NN(CC(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22F2N4O3S/c1-6-23-13(25)10-7-18-9(2)19-12(10)20-21(8-11(16)17)14(22)24-15(3,4)5/h7,11H,6,8H2,1-5H3,(H,18,19,20) |
| InChIKey | FIAFCTLRUBOMJF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|