C19H28FN3O5 — CID 167514000
(2S)-1-[2-fluoro-4-nitro-6-[2-(oxan-2-yloxy)ethoxy]phenyl]-2,4-dimethylpiperazine (PubChem CID 167514000) has the molecular formula C19H28FN3O5 and a molecular weight of 397.45 g/mol. Its IUPAC name is (2S)-1-[2-fluoro-4-nitro-6-[2-(oxan-2-yloxy)ethoxy]phenyl]-2,4-dimethylpiperazine.
| Compound Name | (2S)-1-[2-fluoro-4-nitro-6-[2-(oxan-2-yloxy)ethoxy]phenyl]-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 167514000 |
| Molecular Formula | C19H28FN3O5 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (2S)-1-[2-fluoro-4-nitro-6-[2-(oxan-2-yloxy)ethoxy]phenyl]-2,4-dimethylpiperazine |
| SMILES | C[C@H]1CN(C)CCN1c1c(F)cc([N+](=O)[O-])cc1OCCOC1CCCCO1 |
| InChI | InChI=1S/C19H28FN3O5/c1-14-13-21(2)6-7-22(14)19-16(20)11-15(23(24)25)12-17(19)26-9-10-28-18-5-3-4-8-27-18/h11-12,14,18H,3-10,13H2,1-2H3/t14-,18?/m0/s1 |
| InChIKey | UNTCWTMAYLJWRE-PIVQAISJSA-N |
| XLogP | 2.80 |
| TPSA | 77.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|