C9H9F6N — CID 167515097
(Z)-1,1,1-trifluoro-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pent-3-en-2-imine (PubChem CID 167515097) has the molecular formula C9H9F6N and a molecular weight of 245.17 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pent-3-en-2-imine.
| Compound Name | (Z)-1,1,1-trifluoro-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 167515097 |
| Molecular Formula | C9H9F6N |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | (Z)-1,1,1-trifluoro-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pent-3-en-2-imine |
| SMILES | C/C=C\C(=N\C(=C/C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H9F6N/c1-3-5-7(9(13,14)15)16-6(4-2)8(10,11)12/h3-5H,1-2H3/b5-3-,6-4-,16-7- |
| InChIKey | HFYJYRUBQWYNLP-UAOURNGISA-N |
| XLogP | 4.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|