C16H2Br8 — CID 167515586
1,2,3,4,5,6,7,8-octabromopyrene (PubChem CID 167515586) has the molecular formula C16H2Br8 and a molecular weight of 833.42 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octabromopyrene.
| Compound Name | 1,2,3,4,5,6,7,8-octabromopyrene |
|---|---|
| PubChem CID | 167515586 |
| Molecular Formula | C16H2Br8 |
| Molecular Weight | 833.42 g/mol |
| Exact Mass | 825.36 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octabromopyrene |
| SMILES | Brc1c(Br)c2ccc3c(Br)c(Br)c(Br)c4c(Br)c(Br)c(c1Br)c2c34 |
| InChI | InChI=1S/C16H2Br8/c17-9-3-1-2-4-6-5(3)7(13(21)15(9)23)11(19)12(20)8(6)14(22)16(24)10(4)18/h1-2H |
| InChIKey | RSHUAVQVYPOATN-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.42 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|