C24H6Br4Cl6SSi2 — CID 167515627
7,8,9,10-tetrabromo-11,12-bis(trichlorosilyl)coronene-1-thiol (PubChem CID 167515627) has the molecular formula C24H6Br4Cl6SSi2 and a molecular weight of 914.88 g/mol. Its IUPAC name is 7,8,9,10-tetrabromo-11,12-bis(trichlorosilyl)coronene-1-thiol.
| Compound Name | 7,8,9,10-tetrabromo-11,12-bis(trichlorosilyl)coronene-1-thiol |
|---|---|
| PubChem CID | 167515627 |
| Molecular Formula | C24H6Br4Cl6SSi2 |
| Molecular Weight | 914.88 g/mol |
| Exact Mass | 907.46 |
| IUPAC Name | 7,8,9,10-tetrabromo-11,12-bis(trichlorosilyl)coronene-1-thiol |
| SMILES | Sc1cc2ccc3ccc4c(Br)c(Br)c5c(Br)c(Br)c6c([Si](Cl)(Cl)Cl)c([Si](Cl)(Cl)Cl)c1c1c2c3c4c5c61 |
| InChI | InChI=1S/C24H6Br4Cl6SSi2/c25-19-8-4-3-6-1-2-7-5-9(35)13-14-11(7)10(6)12(8)15-16(14)18(22(28)21(27)17(15)20(19)26)24(37(32,33)34)23(13)36(29,30)31/h1-5,35H |
| InChIKey | SYQPVQBORNZURE-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.88 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|