About 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene
4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene (PubChem CID 16751636) has the molecular formula C12H21Cl2O3P
and a molecular weight of 315.18 g/mol. Its IUPAC name is 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene.
Molecular Properties
| Compound Name | 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene |
| PubChem CID | 16751636 |
| Molecular Formula | C12H21Cl2O3P |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene |
| SMILES | CC1=C(C)CC(P(=O)(OCCCl)OCCCl)CC1 |
| InChI | InChI=1S/C12H21Cl2O3P/c1-10-3-4-12(9-11(10)2)18(15,16-7-5-13)17-8-6-14/h12H,3-9H2,1-2H3 |
| InChIKey | TZUQCFPKUZMGPB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene?
The IUPAC name of 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene (CID 16751636) is 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene.
What is the SMILES notation for 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene?
The canonical SMILES for 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene is CC1=C(C)CC(P(=O)(OCCCl)OCCCl)CC1.
What is the InChIKey of 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene?
The InChIKey is TZUQCFPKUZMGPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21Cl2O3P/c1-10-3-4-12(9-11(10)2)18(15,16-7-5-13)17-8-6-14/h12H,3-9H2,1-2H3.
What are the key properties of 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene?
4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene has a molecular weight of 315.18 g/mol, XLogP of 4.58, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(2-chloroethoxy)phosphoryl]-1,2-dimethylcyclohexene is sourced from PubChem (CID 16751636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).