C19H29ClN2O3 — CID 167516373
(3S)-3-amino-7-(3-cyclohexylpropoxy)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride (PubChem CID 167516373) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is (3S)-3-amino-7-(3-cyclohexylpropoxy)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride.
| Compound Name | (3S)-3-amino-7-(3-cyclohexylpropoxy)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride |
|---|---|
| PubChem CID | 167516373 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (3S)-3-amino-7-(3-cyclohexylpropoxy)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride |
| SMILES | CN1C(=O)[C@@H](N)COc2ccc(OCCCC3CCCCC3)cc21.Cl |
| InChI | InChI=1S/C19H28N2O3.ClH/c1-21-17-12-15(9-10-18(17)24-13-16(20)19(21)22)23-11-5-8-14-6-3-2-4-7-14;/h9-10,12,14,16H,2-8,11,13,20H2,1H3;1H/t16-;/m0./s1 |
| InChIKey | APOBJTBSACCBOF-NTISSMGPSA-N |
| XLogP | 3.53 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|