C12H19F3N4 — CID 167516506
ethane;ethene;(3E)-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]penta-1,3-dien-2-amine (PubChem CID 167516506) has the molecular formula C12H19F3N4 and a molecular weight of 276.31 g/mol. Its IUPAC name is ethane;ethene;(3E)-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]penta-1,3-dien-2-amine.
| Compound Name | ethane;ethene;(3E)-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 167516506 |
| Molecular Formula | C12H19F3N4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethane;ethene;(3E)-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]penta-1,3-dien-2-amine |
| SMILES | C=C.C=C(N)/C(=C\C)c1n[nH]c(C(F)(F)F)n1.CC |
| InChI | InChI=1S/C8H9F3N4.C2H6.C2H4/c1-3-5(4(2)12)6-13-7(15-14-6)8(9,10)11;2*1-2/h3H,2,12H2,1H3,(H,13,14,15);1-2H3;1-2H2/b5-3+;; |
| InChIKey | NJFFTNCSXZNCLZ-RQCPZROWSA-N |
| XLogP | 3.53 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|