C17H24ClNO4S — CID 167518105
2-[1-(2-chloro-4-ethyl-5-propan-2-yloxyanilino)-1-oxopropan-2-yl]sulfanylpropanoic acid (PubChem CID 167518105) has the molecular formula C17H24ClNO4S and a molecular weight of 373.90 g/mol. Its IUPAC name is 2-[1-(2-chloro-4-ethyl-5-propan-2-yloxyanilino)-1-oxopropan-2-yl]sulfanylpropanoic acid.
| Compound Name | 2-[1-(2-chloro-4-ethyl-5-propan-2-yloxyanilino)-1-oxopropan-2-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 167518105 |
| Molecular Formula | C17H24ClNO4S |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[1-(2-chloro-4-ethyl-5-propan-2-yloxyanilino)-1-oxopropan-2-yl]sulfanylpropanoic acid |
| SMILES | CCc1cc(Cl)c(NC(=O)C(C)SC(C)C(=O)O)cc1OC(C)C |
| InChI | InChI=1S/C17H24ClNO4S/c1-6-12-7-13(18)14(8-15(12)23-9(2)3)19-16(20)10(4)24-11(5)17(21)22/h7-11H,6H2,1-5H3,(H,19,20)(H,21,22) |
| InChIKey | VTBHJQKCZOXGGA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |