C22H26N2O7 — CID 16751971
diethyl 2-(cyclohexylamino)-5-(4-nitrophenyl)furan-3,4-dicarboxylate (PubChem CID 16751971) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is diethyl 2-(cyclohexylamino)-5-(4-nitrophenyl)furan-3,4-dicarboxylate.
| Compound Name | diethyl 2-(cyclohexylamino)-5-(4-nitrophenyl)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 16751971 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | diethyl 2-(cyclohexylamino)-5-(4-nitrophenyl)furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC2CCCCC2)oc(-c2ccc([N+](=O)[O-])cc2)c1C(=O)OCC |
| InChI | InChI=1S/C22H26N2O7/c1-3-29-21(25)17-18(22(26)30-4-2)20(23-15-8-6-5-7-9-15)31-19(17)14-10-12-16(13-11-14)24(27)28/h10-13,15,23H,3-9H2,1-2H3 |
| InChIKey | SETVNLZMDQKEHE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|